About (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one
(E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one (PubChem CID 144571727) has the molecular formula C10H14F3NO
and a molecular weight of 221.22 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one.
Molecular Properties
| Compound Name | (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one |
| PubChem CID | 144571727 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one |
| SMILES | CC1CCCN(C(=O)/C=C/C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3NO/c1-8-3-2-6-14(7-8)9(15)4-5-10(11,12)13/h4-5,8H,2-3,6-7H2,1H3/b5-4+ |
| InChIKey | OYWICUQFXYXUCE-SNAWJCMRSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one?
The IUPAC name of (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one (CID 144571727) is (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one.
What is the SMILES notation for (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one?
The canonical SMILES for (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one is CC1CCCN(C(=O)/C=C/C(F)(F)F)C1.
What is the InChIKey of (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one?
The InChIKey is OYWICUQFXYXUCE-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H14F3NO/c1-8-3-2-6-14(7-8)9(15)4-5-10(11,12)13/h4-5,8H,2-3,6-7H2,1H3/b5-4+.
What are the key properties of (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one?
(E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one has a molecular weight of 221.22 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4,4-trifluoro-1-(3-methylpiperidin-1-yl)but-2-en-1-one is sourced from PubChem (CID 144571727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).