C20H27ClN2O — CID 144572021
2-tert-butyl-4-chloro-5-[(1E,3E,4Z)-3-ethylidene-6-methylidenenona-1,4-dienyl]pyridazin-3-one (PubChem CID 144572021) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[(1E,3E,4Z)-3-ethylidene-6-methylidenenona-1,4-dienyl]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[(1E,3E,4Z)-3-ethylidene-6-methylidenenona-1,4-dienyl]pyridazin-3-one |
|---|---|
| PubChem CID | 144572021 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[(1E,3E,4Z)-3-ethylidene-6-methylidenenona-1,4-dienyl]pyridazin-3-one |
| SMILES | C=C(/C=C/C(/C=C/c1cnn(C(C)(C)C)c(=O)c1Cl)=C\C)CCC |
| InChI | InChI=1S/C20H27ClN2O/c1-7-9-15(3)10-11-16(8-2)12-13-17-14-22-23(20(4,5)6)19(24)18(17)21/h8,10-14H,3,7,9H2,1-2,4-6H3/b11-10-,13-12+,16-8+ |
| InChIKey | GEXYNMXQKJKNLT-LGPGWPLNSA-N |
| XLogP | 5.52 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|