About methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate
methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate (PubChem CID 144572149) has the molecular formula C16H20O2S
and a molecular weight of 276.40 g/mol. Its IUPAC name is methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate |
| PubChem CID | 144572149 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2C#CS(C)(C)C)CC1 |
| InChI | InChI=1S/C16H20O2S/c1-18-15(17)16(10-11-16)14-8-6-5-7-13(14)9-12-19(2,3)4/h5-8H,10-11H2,1-4H3 |
| InChIKey | VFNIETORQNHXTO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate (CID 144572149) is methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate is COC(=O)C1(c2ccccc2C#CS(C)(C)C)CC1.
What is the InChIKey of methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate?
The InChIKey is VFNIETORQNHXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O2S/c1-18-15(17)16(10-11-16)14-8-6-5-7-13(14)9-12-19(2,3)4/h5-8H,10-11H2,1-4H3.
What are the key properties of methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate?
methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate has a molecular weight of 276.40 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]phenyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 144572149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).