About 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine
2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine (PubChem CID 14457265) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine.
Molecular Properties
| Compound Name | 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine |
| PubChem CID | 14457265 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine |
| SMILES | CCCCC(CC)C1=NCCCN1C |
| InChI | InChI=1S/C12H24N2/c1-4-6-8-11(5-2)12-13-9-7-10-14(12)3/h11H,4-10H2,1-3H3 |
| InChIKey | FTKOUDOKOBYDKB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine (CID 14457265) is 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine is CCCCC(CC)C1=NCCCN1C.
What is the InChIKey of 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine?
The InChIKey is FTKOUDOKOBYDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-4-6-8-11(5-2)12-13-9-7-10-14(12)3/h11H,4-10H2,1-3H3.
What are the key properties of 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine?
2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine has a molecular weight of 196.34 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-3-yl-1-methyl-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 14457265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).