About 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile
2-amino-3,5,6-trifluoro-4-methoxybenzonitrile (PubChem CID 14457268) has the molecular formula C8H5F3N2O
and a molecular weight of 202.13 g/mol. Its IUPAC name is 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile.
Molecular Properties
| Compound Name | 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile |
| PubChem CID | 14457268 |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile |
| SMILES | COc1c(F)c(N)c(C#N)c(F)c1F |
| InChI | InChI=1S/C8H5F3N2O/c1-14-8-5(10)4(9)3(2-12)7(13)6(8)11/h13H2,1H3 |
| InChIKey | ACWJJLROZVFXJB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile?
The IUPAC name of 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile (CID 14457268) is 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile.
What is the SMILES notation for 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile?
The canonical SMILES for 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile is COc1c(F)c(N)c(C#N)c(F)c1F.
What is the InChIKey of 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile?
The InChIKey is ACWJJLROZVFXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2O/c1-14-8-5(10)4(9)3(2-12)7(13)6(8)11/h13H2,1H3.
What are the key properties of 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile?
2-amino-3,5,6-trifluoro-4-methoxybenzonitrile has a molecular weight of 202.13 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,5,6-trifluoro-4-methoxybenzonitrile is sourced from PubChem (CID 14457268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).