C25H32N4O4 — CID 144572721
7,8-dimethoxy-N,4-dimethyl-1-[4-[methyl(4-oxobutyl)amino]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 144572721) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 7,8-dimethoxy-N,4-dimethyl-1-[4-[methyl(4-oxobutyl)amino]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 7,8-dimethoxy-N,4-dimethyl-1-[4-[methyl(4-oxobutyl)amino]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 144572721 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 7,8-dimethoxy-N,4-dimethyl-1-[4-[methyl(4-oxobutyl)amino]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(N(C)CCCC=O)cc2)c2cc(OC)c(OC)cc2CC1C |
| InChI | InChI=1S/C25H32N4O4/c1-17-14-19-15-22(32-4)23(33-5)16-21(19)24(27-29(17)25(31)26-2)18-8-10-20(11-9-18)28(3)12-6-7-13-30/h8-11,13,15-17H,6-7,12,14H2,1-5H3,(H,26,31) |
| InChIKey | OXOFFPCJVIRWBU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|