About 1,5-dimethylazocane;1-methylpiperazine
1,5-dimethylazocane;1-methylpiperazine (PubChem CID 144572789) has the molecular formula C14H31N3
and a molecular weight of 241.42 g/mol. Its IUPAC name is 1,5-dimethylazocane;1-methylpiperazine.
Molecular Properties
| Compound Name | 1,5-dimethylazocane;1-methylpiperazine |
| PubChem CID | 144572789 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | 1,5-dimethylazocane;1-methylpiperazine |
| SMILES | CC1CCCN(C)CCC1.CN1CCNCC1 |
| InChI | InChI=1S/C9H19N.C5H12N2/c1-9-5-3-7-10(2)8-4-6-9;1-7-4-2-6-3-5-7/h9H,3-8H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | HTDJYNZTIVJPTN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethylazocane;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylazocane;1-methylpiperazine?
The IUPAC name of 1,5-dimethylazocane;1-methylpiperazine (CID 144572789) is 1,5-dimethylazocane;1-methylpiperazine.
What is the SMILES notation for 1,5-dimethylazocane;1-methylpiperazine?
The canonical SMILES for 1,5-dimethylazocane;1-methylpiperazine is CC1CCCN(C)CCC1.CN1CCNCC1.
What is the InChIKey of 1,5-dimethylazocane;1-methylpiperazine?
The InChIKey is HTDJYNZTIVJPTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C5H12N2/c1-9-5-3-7-10(2)8-4-6-9;1-7-4-2-6-3-5-7/h9H,3-8H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of 1,5-dimethylazocane;1-methylpiperazine?
1,5-dimethylazocane;1-methylpiperazine has a molecular weight of 241.42 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylazocane;1-methylpiperazine is sourced from PubChem (CID 144572789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).