C16H32N2 — CID 144572958
(3Z,5R)-N,N-dimethyl-5-piperidin-2-ylhepta-1,3-dien-2-amine;ethane (PubChem CID 144572958) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (3Z,5R)-N,N-dimethyl-5-piperidin-2-ylhepta-1,3-dien-2-amine;ethane.
| Compound Name | (3Z,5R)-N,N-dimethyl-5-piperidin-2-ylhepta-1,3-dien-2-amine;ethane |
|---|---|
| PubChem CID | 144572958 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (3Z,5R)-N,N-dimethyl-5-piperidin-2-ylhepta-1,3-dien-2-amine;ethane |
| SMILES | C=C(/C=C\C(CC)C1CCCCN1)N(C)C.CC |
| InChI | InChI=1S/C14H26N2.C2H6/c1-5-13(10-9-12(2)16(3)4)14-8-6-7-11-15-14;1-2/h9-10,13-15H,2,5-8,11H2,1,3-4H3;1-2H3/b10-9-; |
| InChIKey | IZKVUNJTCONOTQ-KVVVOXFISA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|