C54H49N3 — CID 144573328
(1Z,3E,5R)-1,3-di(cyclohexa-1,5-dien-1-yl)-5-[5-[3-(9-phenylcarbazol-2-yl)-1,2-dihydrocarbazol-9-yl]cyclohexa-1,3-dien-1-yl]hexa-1,3-dien-1-amine (PubChem CID 144573328) has the molecular formula C54H49N3 and a molecular weight of 740.01 g/mol. Its IUPAC name is (1Z,3E,5R)-1,3-di(cyclohexa-1,5-dien-1-yl)-5-[5-[3-(9-phenylcarbazol-2-yl)-1,2-dihydrocarbazol-9-yl]cyclohexa-1,3-dien-1-yl]hexa-1,3-dien-1-amine.
| Compound Name | (1Z,3E,5R)-1,3-di(cyclohexa-1,5-dien-1-yl)-5-[5-[3-(9-phenylcarbazol-2-yl)-1,2-dihydrocarbazol-9-yl]cyclohexa-1,3-dien-1-yl]hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144573328 |
| Molecular Formula | C54H49N3 |
| Molecular Weight | 740.01 g/mol |
| Exact Mass | 739.39 |
| IUPAC Name | (1Z,3E,5R)-1,3-di(cyclohexa-1,5-dien-1-yl)-5-[5-[3-(9-phenylcarbazol-2-yl)-1,2-dihydrocarbazol-9-yl]cyclohexa-1,3-dien-1-yl]hexa-1,3-dien-1-amine |
| SMILES | C[C@H](/C=C(\C=C(/N)C1=CCCC=C1)C1=CCCC=C1)C1=CC=CC(n2c3c(c4ccccc42)C=C(c2ccc4c5ccccc5n(-c5ccccc5)c4c2)CC3)C1 |
| InChI | InChI=1S/C54H49N3/c1-37(32-43(38-16-5-2-6-17-38)35-50(55)39-18-7-3-8-19-39)40-20-15-23-45(33-40)57-52-27-14-12-25-47(52)49-34-41(29-31-53(49)57)42-28-30-48-46-24-11-13-26-51(46)56(54(48)36-42)44-21-9-4-10-22-44/h4-5,7,9-28,30,32,34-37,45H,2-3,6,8,29,31,33,55H2,1H3/b43-32+,50-35-/t37-,45?/m1/s1 |
| InChIKey | XRAMMBQACBJELE-PZXQXTDVSA-N |
| XLogP | 13.61 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.01 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|