About methyl 12,12-dicyanododecanoate
methyl 12,12-dicyanododecanoate (PubChem CID 14457355) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl 12,12-dicyanododecanoate.
Molecular Properties
| Compound Name | methyl 12,12-dicyanododecanoate |
| PubChem CID | 14457355 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | methyl 12,12-dicyanododecanoate |
| SMILES | COC(=O)CCCCCCCCCCC(C#N)C#N |
| InChI | InChI=1S/C15H24N2O2/c1-19-15(18)11-9-7-5-3-2-4-6-8-10-14(12-16)13-17/h14H,2-11H2,1H3 |
| InChIKey | PFYRTHVQUDBNLM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 12,12-dicyanododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 12,12-dicyanododecanoate?
The IUPAC name of methyl 12,12-dicyanododecanoate (CID 14457355) is methyl 12,12-dicyanododecanoate.
What is the SMILES notation for methyl 12,12-dicyanododecanoate?
The canonical SMILES for methyl 12,12-dicyanododecanoate is COC(=O)CCCCCCCCCCC(C#N)C#N.
What is the InChIKey of methyl 12,12-dicyanododecanoate?
The InChIKey is PFYRTHVQUDBNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-19-15(18)11-9-7-5-3-2-4-6-8-10-14(12-16)13-17/h14H,2-11H2,1H3.
What are the key properties of methyl 12,12-dicyanododecanoate?
methyl 12,12-dicyanododecanoate has a molecular weight of 264.37 g/mol, XLogP of 3.72, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 12,12-dicyanododecanoate is sourced from PubChem (CID 14457355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).