C65H48N4 — CID 144573691
9-[(2E,4E)-4,6-diphenylhepta-2,4-dien-2-yl]-3-(4,6-diphenylpyrimidin-2-yl)-6-(9-phenylcarbazol-3-yl)carbazole (PubChem CID 144573691) has the molecular formula C65H48N4 and a molecular weight of 885.13 g/mol. Its IUPAC name is 9-[(2E,4E)-4,6-diphenylhepta-2,4-dien-2-yl]-3-(4,6-diphenylpyrimidin-2-yl)-6-(9-phenylcarbazol-3-yl)carbazole.
| Compound Name | 9-[(2E,4E)-4,6-diphenylhepta-2,4-dien-2-yl]-3-(4,6-diphenylpyrimidin-2-yl)-6-(9-phenylcarbazol-3-yl)carbazole |
|---|---|
| PubChem CID | 144573691 |
| Molecular Formula | C65H48N4 |
| Molecular Weight | 885.13 g/mol |
| Exact Mass | 884.39 |
| IUPAC Name | 9-[(2E,4E)-4,6-diphenylhepta-2,4-dien-2-yl]-3-(4,6-diphenylpyrimidin-2-yl)-6-(9-phenylcarbazol-3-yl)carbazole |
| SMILES | C/C(=C\C(=C/C(C)c1ccccc1)c1ccccc1)n1c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc2c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C65H48N4/c1-44(46-20-8-3-9-21-46)38-53(47-22-10-4-11-23-47)39-45(2)68-62-35-32-51(50-33-36-64-56(40-50)55-30-18-19-31-61(55)69(64)54-28-16-7-17-29-54)41-57(62)58-42-52(34-37-63(58)68)65-66-59(48-24-12-5-13-25-48)43-60(67-65)49-26-14-6-15-27-49/h3-44H,1-2H3/b45-39+,53-38+ |
| InChIKey | IBACWNBLHIQNLC-IJUUASSSSA-N |
| XLogP | 17.10 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.13 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|