C62H40N6 — CID 144573714
3-(3-carbazol-9-ylphenyl)-6-(4,6-diphenyl-2-pyridinyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 144573714) has the molecular formula C62H40N6 and a molecular weight of 869.04 g/mol. Its IUPAC name is 3-(3-carbazol-9-ylphenyl)-6-(4,6-diphenyl-2-pyridinyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 3-(3-carbazol-9-ylphenyl)-6-(4,6-diphenyl-2-pyridinyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 144573714 |
| Molecular Formula | C62H40N6 |
| Molecular Weight | 869.04 g/mol |
| Exact Mass | 868.33 |
| IUPAC Name | 3-(3-carbazol-9-ylphenyl)-6-(4,6-diphenyl-2-pyridinyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc4c(c3)c3cc(-c5cccc(-n6c7ccccc7c7ccccc76)c5)ccc3n4-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C62H40N6/c1-5-18-41(19-6-1)48-39-54(42-20-7-2-8-21-42)63-55(40-48)47-33-35-59-53(38-47)52-37-46(45-26-17-27-49(36-45)67-56-30-15-13-28-50(56)51-29-14-16-31-57(51)67)32-34-58(52)68(59)62-65-60(43-22-9-3-10-23-43)64-61(66-62)44-24-11-4-12-25-44/h1-40H |
| InChIKey | RKHHFIAYVGLPSU-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.04 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |