C24H31ClF2N4O5S2 — CID 144574188
2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-[methyl(2-piperidin-1-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide (PubChem CID 144574188) has the molecular formula C24H31ClF2N4O5S2 and a molecular weight of 593.12 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-[methyl(2-piperidin-1-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-[methyl(2-piperidin-1-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 144574188 |
| Molecular Formula | C24H31ClF2N4O5S2 |
| Molecular Weight | 593.12 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-[methyl(2-piperidin-1-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide |
| SMILES | CN(CCN(CC(=O)NO)S(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)S(=O)CCN1CCCCC1 |
| InChI | InChI=1S/C24H31ClF2N4O5S2/c1-29(37(34)14-13-30-9-3-2-4-10-30)11-12-31(17-23(32)28-33)38(35)20-15-21(26)24(22(27)16-20)36-19-7-5-18(25)6-8-19/h5-8,15-16,33H,2-4,9-14,17H2,1H3,(H,28,32) |
| InChIKey | YLLCEWAEAJVCRE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|