C24H23ClF2N4O4S2 — CID 144574271
acetylene;2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl-[(2-oxo-1H-pyridin-3-yl)sulfanyl]amino]ethyl]amino]-N-hydroxyacetamide (PubChem CID 144574271) has the molecular formula C24H23ClF2N4O4S2 and a molecular weight of 569.06 g/mol. Its IUPAC name is acetylene;2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl-[(2-oxo-1H-pyridin-3-yl)sulfanyl]amino]ethyl]amino]-N-hydroxyacetamide.
| Compound Name | acetylene;2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl-[(2-oxo-1H-pyridin-3-yl)sulfanyl]amino]ethyl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 144574271 |
| Molecular Formula | C24H23ClF2N4O4S2 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | acetylene;2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl-[(2-oxo-1H-pyridin-3-yl)sulfanyl]amino]ethyl]amino]-N-hydroxyacetamide |
| SMILES | C#C.CN(CCN(CC(=O)NO)Sc1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)Sc1ccc[nH]c1=O |
| InChI | InChI=1S/C22H21ClF2N4O4S2.C2H2/c1-28(35-19-3-2-8-26-22(19)31)9-10-29(13-20(30)27-32)34-16-11-17(24)21(18(25)12-16)33-15-6-4-14(23)5-7-15;1-2/h2-8,11-12,32H,9-10,13H2,1H3,(H,26,31)(H,27,30);1-2H |
| InChIKey | ABFQPKWMAKHZDM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|