About ethane;piperidin-4-yl acetate
ethane;piperidin-4-yl acetate (PubChem CID 144574283) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is ethane;piperidin-4-yl acetate.
Molecular Properties
| Compound Name | ethane;piperidin-4-yl acetate |
| PubChem CID | 144574283 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | ethane;piperidin-4-yl acetate |
| SMILES | CC.CC(=O)OC1CCNCC1 |
| InChI | InChI=1S/C7H13NO2.C2H6/c1-6(9)10-7-2-4-8-5-3-7;1-2/h7-8H,2-5H2,1H3;1-2H3 |
| InChIKey | OIQMLHOAOWKQPP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;piperidin-4-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;piperidin-4-yl acetate?
The IUPAC name of ethane;piperidin-4-yl acetate (CID 144574283) is ethane;piperidin-4-yl acetate.
What is the SMILES notation for ethane;piperidin-4-yl acetate?
The canonical SMILES for ethane;piperidin-4-yl acetate is CC.CC(=O)OC1CCNCC1.
What is the InChIKey of ethane;piperidin-4-yl acetate?
The InChIKey is OIQMLHOAOWKQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C2H6/c1-6(9)10-7-2-4-8-5-3-7;1-2/h7-8H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;piperidin-4-yl acetate?
ethane;piperidin-4-yl acetate has a molecular weight of 173.26 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;piperidin-4-yl acetate is sourced from PubChem (CID 144574283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).