C31H31FN4O4 — CID 144574575
2-[(23E)-18-fluoro-4,27-dimethyl-21,26-dioxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15(20),16,18,23-undecaen-3-yl]acetic acid (PubChem CID 144574575) has the molecular formula C31H31FN4O4 and a molecular weight of 542.61 g/mol. Its IUPAC name is 2-[(23E)-18-fluoro-4,27-dimethyl-21,26-dioxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15(20),16,18,23-undecaen-3-yl]acetic acid.
| Compound Name | 2-[(23E)-18-fluoro-4,27-dimethyl-21,26-dioxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15(20),16,18,23-undecaen-3-yl]acetic acid |
|---|---|
| PubChem CID | 144574575 |
| Molecular Formula | C31H31FN4O4 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2-[(23E)-18-fluoro-4,27-dimethyl-21,26-dioxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15(20),16,18,23-undecaen-3-yl]acetic acid |
| SMILES | Cc1nc2cc3nn2c(c1CC(=O)O)N1CCC(C)(CC1)OC/C=C/COc1cc(F)ccc1-c1cccc-3c1 |
| InChI | InChI=1S/C31H31FN4O4/c1-20-25(18-29(37)38)30-35-12-10-31(2,11-13-35)40-15-4-3-14-39-27-17-23(32)8-9-24(27)21-6-5-7-22(16-21)26-19-28(33-20)36(30)34-26/h3-9,16-17,19H,10-15,18H2,1-2H3,(H,37,38)/b4-3+ |
| InChIKey | YDYCISMHEZPIAH-ONEGZZNKSA-N |
| XLogP | 5.46 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|