C18H16ClF3N2O — CID 144574802
[2-chloro-6-(trifluoromethyl)phenyl]-(3-methylindazol-1-yl)methanone;ethane (PubChem CID 144574802) has the molecular formula C18H16ClF3N2O and a molecular weight of 368.79 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)phenyl]-(3-methylindazol-1-yl)methanone;ethane.
| Compound Name | [2-chloro-6-(trifluoromethyl)phenyl]-(3-methylindazol-1-yl)methanone;ethane |
|---|---|
| PubChem CID | 144574802 |
| Molecular Formula | C18H16ClF3N2O |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)phenyl]-(3-methylindazol-1-yl)methanone;ethane |
| SMILES | CC.Cc1nn(C(=O)c2c(Cl)cccc2C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H10ClF3N2O.C2H6/c1-9-10-5-2-3-8-13(10)22(21-9)15(23)14-11(16(18,19)20)6-4-7-12(14)17;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | WJUOYXUGOFXMGU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |