C15H25NO — CID 144574804
(2E,3Z)-N-cyclopropyl-2-ethylidene-4,5-dimethylhexa-3,5-dienamide;ethane (PubChem CID 144574804) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2E,3Z)-N-cyclopropyl-2-ethylidene-4,5-dimethylhexa-3,5-dienamide;ethane.
| Compound Name | (2E,3Z)-N-cyclopropyl-2-ethylidene-4,5-dimethylhexa-3,5-dienamide;ethane |
|---|---|
| PubChem CID | 144574804 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2E,3Z)-N-cyclopropyl-2-ethylidene-4,5-dimethylhexa-3,5-dienamide;ethane |
| SMILES | C=C(C)/C(C)=C\C(=C/C)C(=O)NC1CC1.CC |
| InChI | InChI=1S/C13H19NO.C2H6/c1-5-11(8-10(4)9(2)3)13(15)14-12-6-7-12;1-2/h5,8,12H,2,6-7H2,1,3-4H3,(H,14,15);1-2H3/b10-8-,11-5+; |
| InChIKey | JGXCTVXTXXEALS-JHKYVUOISA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|