C25H20BClF4N2O5 — CID 144574876
[1-[2-chloro-6-(trifluoromethyl)benzoyl]-3-(2-fluoro-4-methoxycarbonylphenyl)indazol-6-yl]boronic acid;ethane (PubChem CID 144574876) has the molecular formula C25H20BClF4N2O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is [1-[2-chloro-6-(trifluoromethyl)benzoyl]-3-(2-fluoro-4-methoxycarbonylphenyl)indazol-6-yl]boronic acid;ethane.
| Compound Name | [1-[2-chloro-6-(trifluoromethyl)benzoyl]-3-(2-fluoro-4-methoxycarbonylphenyl)indazol-6-yl]boronic acid;ethane |
|---|---|
| PubChem CID | 144574876 |
| Molecular Formula | C25H20BClF4N2O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | [1-[2-chloro-6-(trifluoromethyl)benzoyl]-3-(2-fluoro-4-methoxycarbonylphenyl)indazol-6-yl]boronic acid;ethane |
| SMILES | CC.COC(=O)c1ccc(-c2nn(C(=O)c3c(Cl)cccc3C(F)(F)F)c3cc(B(O)O)ccc23)c(F)c1 |
| InChI | InChI=1S/C23H14BClF4N2O5.C2H6/c1-36-22(33)11-5-7-13(17(26)9-11)20-14-8-6-12(24(34)35)10-18(14)31(30-20)21(32)19-15(23(27,28)29)3-2-4-16(19)25;1-2/h2-10,34-35H,1H3;1-2H3 |
| InChIKey | KCFCSCPGLDNSIH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|