C21H14F4N2O2 — CID 144574931
4-[2-[(2,5-difluorophenyl)methylamino]-6-fluorobenzenecarboximidoyl]-3-fluorobenzoic acid (PubChem CID 144574931) has the molecular formula C21H14F4N2O2 and a molecular weight of 402.35 g/mol. Its IUPAC name is 4-[2-[(2,5-difluorophenyl)methylamino]-6-fluorobenzenecarboximidoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[2-[(2,5-difluorophenyl)methylamino]-6-fluorobenzenecarboximidoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 144574931 |
| Molecular Formula | C21H14F4N2O2 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 4-[2-[(2,5-difluorophenyl)methylamino]-6-fluorobenzenecarboximidoyl]-3-fluorobenzoic acid |
| SMILES | [H]/N=C(\c1ccc(C(=O)O)cc1F)c1c(F)cccc1NCc1cc(F)ccc1F |
| InChI | InChI=1S/C21H14F4N2O2/c22-13-5-7-15(23)12(8-13)10-27-18-3-1-2-16(24)19(18)20(26)14-6-4-11(21(28)29)9-17(14)25/h1-9,26-27H,10H2,(H,28,29)/b26-20+ |
| InChIKey | GIOIZHKPHMXHFV-LHLOQNFPSA-N |
| XLogP | 4.97 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|