About ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate
ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate (PubChem CID 144575126) has the molecular formula C20H30FNO4
and a molecular weight of 367.46 g/mol. Its IUPAC name is ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate.
Molecular Properties
| Compound Name | ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate |
| PubChem CID | 144575126 |
| Molecular Formula | C20H30FNO4 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate |
| SMILES | CC.COC(=O)c1cc(F)c(N(C(=O)C(C)(C)C)C2CCC2)c(OC)c1 |
| InChI | InChI=1S/C18H24FNO4.C2H6/c1-18(2,3)17(22)20(12-7-6-8-12)15-13(19)9-11(16(21)24-5)10-14(15)23-4;1-2/h9-10,12H,6-8H2,1-5H3;1-2H3 |
| InChIKey | SFTITHJFAKJMGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate?
The IUPAC name of ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate (CID 144575126) is ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate.
What is the SMILES notation for ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate?
The canonical SMILES for ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate is CC.COC(=O)c1cc(F)c(N(C(=O)C(C)(C)C)C2CCC2)c(OC)c1.
What is the InChIKey of ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate?
The InChIKey is SFTITHJFAKJMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24FNO4.C2H6/c1-18(2,3)17(22)20(12-7-6-8-12)15-13(19)9-11(16(21)24-5)10-14(15)23-4;1-2/h9-10,12H,6-8H2,1-5H3;1-2H3.
What are the key properties of ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate?
ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate has a molecular weight of 367.46 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4-[cyclobutyl(2,2-dimethylpropanoyl)amino]-3-fluoro-5-methoxybenzoate is sourced from PubChem (CID 144575126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).