C16H18N4O4 — CID 14457530
methyl 1-[(3-methyl-4-nitrophenyl)methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 14457530) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl 1-[(3-methyl-4-nitrophenyl)methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl 1-[(3-methyl-4-nitrophenyl)methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 14457530 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl 1-[(3-methyl-4-nitrophenyl)methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)C1Cc2c(ncn2Cc2ccc([N+](=O)[O-])c(C)c2)CN1 |
| InChI | InChI=1S/C16H18N4O4/c1-10-5-11(3-4-14(10)20(22)23)8-19-9-18-13-7-17-12(6-15(13)19)16(21)24-2/h3-5,9,12,17H,6-8H2,1-2H3 |
| InChIKey | GHEDTCDHGZWIQL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|