C24H37N5O2 — CID 144575488
N'-ethyl-6,8-dimethyl-2-[3-(oxan-4-ylamino)pentylamino]-N-oxo-1,2-dihydroquinoline-3-carboximidamide (PubChem CID 144575488) has the molecular formula C24H37N5O2 and a molecular weight of 427.59 g/mol. Its IUPAC name is N'-ethyl-6,8-dimethyl-2-[3-(oxan-4-ylamino)pentylamino]-N-oxo-1,2-dihydroquinoline-3-carboximidamide.
| Compound Name | N'-ethyl-6,8-dimethyl-2-[3-(oxan-4-ylamino)pentylamino]-N-oxo-1,2-dihydroquinoline-3-carboximidamide |
|---|---|
| PubChem CID | 144575488 |
| Molecular Formula | C24H37N5O2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | N'-ethyl-6,8-dimethyl-2-[3-(oxan-4-ylamino)pentylamino]-N-oxo-1,2-dihydroquinoline-3-carboximidamide |
| SMILES | CC/N=C(\N=O)C1=Cc2cc(C)cc(C)c2NC1NCCC(CC)NC1CCOCC1 |
| InChI | InChI=1S/C24H37N5O2/c1-5-19(27-20-8-11-31-12-9-20)7-10-26-23-21(24(29-30)25-6-2)15-18-14-16(3)13-17(4)22(18)28-23/h13-15,19-20,23,26-28H,5-12H2,1-4H3/b25-24- |
| InChIKey | LWOXOGHYWSHIAN-IZHYLOQSSA-N |
| XLogP | 4.15 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|