C24H40FN5O — CID 144575555
3-N-cycloheptyl-1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]pentane-1,3-diamine;ethanol (PubChem CID 144575555) has the molecular formula C24H40FN5O and a molecular weight of 433.62 g/mol. Its IUPAC name is 3-N-cycloheptyl-1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]pentane-1,3-diamine;ethanol.
| Compound Name | 3-N-cycloheptyl-1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]pentane-1,3-diamine;ethanol |
|---|---|
| PubChem CID | 144575555 |
| Molecular Formula | C24H40FN5O |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 3-N-cycloheptyl-1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]pentane-1,3-diamine;ethanol |
| SMILES | CCC(CCNc1nc2ccc(F)cc2cc1C(N)N)NC1CCCCCC1.CCO |
| InChI | InChI=1S/C22H34FN5.C2H6O/c1-2-17(27-18-7-5-3-4-6-8-18)11-12-26-22-19(21(24)25)14-15-13-16(23)9-10-20(15)28-22;1-2-3/h9-10,13-14,17-18,21,27H,2-8,11-12,24-25H2,1H3,(H,26,28);3H,2H2,1H3 |
| InChIKey | OHEXYAGHAKXDRY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|