C24H40N6O2 — CID 144575686
N-(1-aminoethyl)-3-[(2S,3R)-3-(cyclohexylamino)-2-methoxypentyl]imino-7-methyl-2,4-dihydro-1H-quinoxaline-2-carboxamide (PubChem CID 144575686) has the molecular formula C24H40N6O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-(1-aminoethyl)-3-[(2S,3R)-3-(cyclohexylamino)-2-methoxypentyl]imino-7-methyl-2,4-dihydro-1H-quinoxaline-2-carboxamide.
| Compound Name | N-(1-aminoethyl)-3-[(2S,3R)-3-(cyclohexylamino)-2-methoxypentyl]imino-7-methyl-2,4-dihydro-1H-quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 144575686 |
| Molecular Formula | C24H40N6O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | N-(1-aminoethyl)-3-[(2S,3R)-3-(cyclohexylamino)-2-methoxypentyl]imino-7-methyl-2,4-dihydro-1H-quinoxaline-2-carboxamide |
| SMILES | CC[C@@H](NC1CCCCC1)[C@H](C/N=C1\Nc2ccc(C)cc2NC1C(=O)NC(C)N)OC |
| InChI | InChI=1S/C24H40N6O2/c1-5-18(28-17-9-7-6-8-10-17)21(32-4)14-26-23-22(24(31)27-16(3)25)29-20-13-15(2)11-12-19(20)30-23/h11-13,16-18,21-22,28-29H,5-10,14,25H2,1-4H3,(H,26,30)(H,27,31)/t16?,18-,21+,22?/m1/s1 |
| InChIKey | BWCKWLHJRSMQLT-LWUCBAMWSA-N |
| XLogP | 2.74 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|