C16H27N5 — CID 144575891
1-N-[3-(diaminomethyl)-6-methyl-1,8a-dihydroquinolin-2-yl]pentane-1,3-diamine (PubChem CID 144575891) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 1-N-[3-(diaminomethyl)-6-methyl-1,8a-dihydroquinolin-2-yl]pentane-1,3-diamine.
| Compound Name | 1-N-[3-(diaminomethyl)-6-methyl-1,8a-dihydroquinolin-2-yl]pentane-1,3-diamine |
|---|---|
| PubChem CID | 144575891 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 1-N-[3-(diaminomethyl)-6-methyl-1,8a-dihydroquinolin-2-yl]pentane-1,3-diamine |
| SMILES | CCC(N)CCNC1=C(C(N)N)C=C2C=C(C)C=CC2N1 |
| InChI | InChI=1S/C16H27N5/c1-3-12(17)6-7-20-16-13(15(18)19)9-11-8-10(2)4-5-14(11)21-16/h4-5,8-9,12,14-15,20-21H,3,6-7,17-19H2,1-2H3 |
| InChIKey | BGCXDDKLADHXLD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|