C23H43N5O — CID 144575937
(E)-3-(2-amino-5-methylphenyl)-2-[[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]methyl]prop-2-ene-1,1-diamine;ethanol (PubChem CID 144575937) has the molecular formula C23H43N5O and a molecular weight of 405.63 g/mol. Its IUPAC name is (E)-3-(2-amino-5-methylphenyl)-2-[[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]methyl]prop-2-ene-1,1-diamine;ethanol.
| Compound Name | (E)-3-(2-amino-5-methylphenyl)-2-[[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]methyl]prop-2-ene-1,1-diamine;ethanol |
|---|---|
| PubChem CID | 144575937 |
| Molecular Formula | C23H43N5O |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.35 |
| IUPAC Name | (E)-3-(2-amino-5-methylphenyl)-2-[[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]methyl]prop-2-ene-1,1-diamine;ethanol |
| SMILES | CCO.Cc1ccc(N)c(/C=C(\CN2CCC(N[C@H](C)C(C)C)CC2)C(N)N)c1 |
| InChI | InChI=1S/C21H37N5.C2H6O/c1-14(2)16(4)25-19-7-9-26(10-8-19)13-18(21(23)24)12-17-11-15(3)5-6-20(17)22;1-2-3/h5-6,11-12,14,16,19,21,25H,7-10,13,22-24H2,1-4H3;3H,2H2,1H3/b18-12+;/t16-;/m1./s1 |
| InChIKey | NNTATLKZHSKVOH-AITOJSCLSA-N |
| XLogP | 2.30 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|