C19H34N4O — CID 144575960
[2-[[(3R)-3-(cyclohexylamino)pentyl]amino]-5-methyl-3-pyridinyl]-(methylamino)methanol (PubChem CID 144575960) has the molecular formula C19H34N4O and a molecular weight of 334.51 g/mol. Its IUPAC name is [2-[[(3R)-3-(cyclohexylamino)pentyl]amino]-5-methyl-3-pyridinyl]-(methylamino)methanol.
| Compound Name | [2-[[(3R)-3-(cyclohexylamino)pentyl]amino]-5-methyl-3-pyridinyl]-(methylamino)methanol |
|---|---|
| PubChem CID | 144575960 |
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | [2-[[(3R)-3-(cyclohexylamino)pentyl]amino]-5-methyl-3-pyridinyl]-(methylamino)methanol |
| SMILES | CC[C@H](CCNc1ncc(C)cc1C(O)NC)NC1CCCCC1 |
| InChI | InChI=1S/C19H34N4O/c1-4-15(23-16-8-6-5-7-9-16)10-11-21-18-17(19(24)20-3)12-14(2)13-22-18/h12-13,15-16,19-20,23-24H,4-11H2,1-3H3,(H,21,22)/t15-,19?/m1/s1 |
| InChIKey | DQJPMJCJEAYOMH-NYRJJRHWSA-N |
| XLogP | 3.10 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|