C20H15Cl2N3O3 — CID 144576139
N-[3-[[2-(2,3-dichlorophenoxy)acetyl]amino]phenyl]pyridine-4-carboxamide (PubChem CID 144576139) has the molecular formula C20H15Cl2N3O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is N-[3-[[2-(2,3-dichlorophenoxy)acetyl]amino]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[2-(2,3-dichlorophenoxy)acetyl]amino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 144576139 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[3-[[2-(2,3-dichlorophenoxy)acetyl]amino]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(COc1cccc(Cl)c1Cl)Nc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C20H15Cl2N3O3/c21-16-5-2-6-17(19(16)22)28-12-18(26)24-14-3-1-4-15(11-14)25-20(27)13-7-9-23-10-8-13/h1-11H,12H2,(H,24,26)(H,25,27) |
| InChIKey | WNKFWQJBENRKSB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |