About N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine
N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine (PubChem CID 144576337) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine |
| PubChem CID | 144576337 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine |
| SMILES | CC/N=C1\C=C(OC)C(OC)=CC1=C(C)C |
| InChI | InChI=1S/C13H19NO2/c1-6-14-11-8-13(16-5)12(15-4)7-10(11)9(2)3/h7-8H,6H2,1-5H3/b14-11+ |
| InChIKey | KBECPJSEBBRPPU-SDNWHVSQSA-N |
| XLogP | 2.86 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
The IUPAC name of N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine (CID 144576337) is N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine.
What is the SMILES notation for N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
The canonical SMILES for N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine is CC/N=C1\C=C(OC)C(OC)=CC1=C(C)C.
What is the InChIKey of N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
The InChIKey is KBECPJSEBBRPPU-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H19NO2/c1-6-14-11-8-13(16-5)12(15-4)7-10(11)9(2)3/h7-8H,6H2,1-5H3/b14-11+.
What are the key properties of N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine has a molecular weight of 221.30 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,4-dimethoxy-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 144576337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).