C25H33N5O — CID 144576781
[1-[3-[1-(2-methyliminohydrazinyl)ethenyl]-4-(2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl]cyclopentyl]methanol (PubChem CID 144576781) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is [1-[3-[1-(2-methyliminohydrazinyl)ethenyl]-4-(2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl]cyclopentyl]methanol.
| Compound Name | [1-[3-[1-(2-methyliminohydrazinyl)ethenyl]-4-(2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 144576781 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | [1-[3-[1-(2-methyliminohydrazinyl)ethenyl]-4-(2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl]cyclopentyl]methanol |
| SMILES | C=C(N/N=N/C)c1c(C2(CO)CCCC2)nc2c(c1-c1ccnc(C)c1)CCCCC2 |
| InChI | InChI=1S/C25H33N5O/c1-17-15-19(11-14-27-17)23-20-9-5-4-6-10-21(20)28-24(22(23)18(2)29-30-26-3)25(16-31)12-7-8-13-25/h11,14-15,31H,2,4-10,12-13,16H2,1,3H3,(H,26,29) |
| InChIKey | GASQJEPVTZFHEN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|