C21H22BrN5O3S — CID 144576966
5-bromo-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide (PubChem CID 144576966) has the molecular formula C21H22BrN5O3S and a molecular weight of 504.41 g/mol. Its IUPAC name is 5-bromo-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide.
| Compound Name | 5-bromo-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide |
|---|---|
| PubChem CID | 144576966 |
| Molecular Formula | C21H22BrN5O3S |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 5-bromo-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide |
| SMILES | CSc1ccc(CNC(=O)c2cn(-c3onc(C)c3C)c(C)c(Br)c2=O)cc1.N#CN |
| InChI | InChI=1S/C20H20BrN3O3S.CH2N2/c1-11-12(2)23-27-20(11)24-10-16(18(25)17(21)13(24)3)19(26)22-9-14-5-7-15(28-4)8-6-14;2-1-3/h5-8,10H,9H2,1-4H3,(H,22,26);2H2 |
| InChIKey | WKLDFXNUFYITSU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|