C17H22N2O2 — CID 144577348
ethane;12-methyl-5,8-diazatricyclo[9.4.1.02,8]hexadeca-1(15),2,11,13-tetraene-4,7-dione (PubChem CID 144577348) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is ethane;12-methyl-5,8-diazatricyclo[9.4.1.02,8]hexadeca-1(15),2,11,13-tetraene-4,7-dione.
| Compound Name | ethane;12-methyl-5,8-diazatricyclo[9.4.1.02,8]hexadeca-1(15),2,11,13-tetraene-4,7-dione |
|---|---|
| PubChem CID | 144577348 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethane;12-methyl-5,8-diazatricyclo[9.4.1.02,8]hexadeca-1(15),2,11,13-tetraene-4,7-dione |
| SMILES | CC.CC1=C2CCN3C(=O)CNC(=O)C=C3C(=CC=C1)C2 |
| InChI | InChI=1S/C15H16N2O2.C2H6/c1-10-3-2-4-12-7-11(10)5-6-17-13(12)8-14(18)16-9-15(17)19;1-2/h2-4,8H,5-7,9H2,1H3,(H,16,18);1-2H3 |
| InChIKey | VOPCTGWPZVEXHX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |