C18H12S2 — CID 144577722
13,14-bis(ethenyl)-12,16-dithiatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene (PubChem CID 144577722) has the molecular formula C18H12S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 13,14-bis(ethenyl)-12,16-dithiatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene.
| Compound Name | 13,14-bis(ethenyl)-12,16-dithiatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene |
|---|---|
| PubChem CID | 144577722 |
| Molecular Formula | C18H12S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 13,14-bis(ethenyl)-12,16-dithiatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene |
| SMILES | C=Cc1sc2c(sc3cc4ccccc4cc32)c1C=C |
| InChI | InChI=1S/C18H12S2/c1-3-13-15(4-2)19-18-14-9-11-7-5-6-8-12(11)10-16(14)20-17(13)18/h3-10H,1-2H2 |
| InChIKey | WBAXBSGAODURAM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |