About 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane
3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane (PubChem CID 144578072) has the molecular formula C20H37NO2
and a molecular weight of 323.52 g/mol. Its IUPAC name is 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane.
Molecular Properties
| Compound Name | 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane |
| PubChem CID | 144578072 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane |
| SMILES | C=C(C)CC1(C(=O)OC(CC)(CC)C2CCCCC2)CN1.CC |
| InChI | InChI=1S/C18H31NO2.C2H6/c1-5-18(6-2,15-10-8-7-9-11-15)21-16(20)17(13-19-17)12-14(3)4;1-2/h15,19H,3,5-13H2,1-2,4H3;1-2H3 |
| InChIKey | QHDDSUWAKXABKM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane?
The IUPAC name of 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane (CID 144578072) is 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane.
What is the SMILES notation for 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane?
The canonical SMILES for 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane is C=C(C)CC1(C(=O)OC(CC)(CC)C2CCCCC2)CN1.CC.
What is the InChIKey of 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane?
The InChIKey is QHDDSUWAKXABKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO2.C2H6/c1-5-18(6-2,15-10-8-7-9-11-15)21-16(20)17(13-19-17)12-14(3)4;1-2/h15,19H,3,5-13H2,1-2,4H3;1-2H3.
What are the key properties of 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane?
3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane has a molecular weight of 323.52 g/mol, XLogP of 5.00, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpentan-3-yl 2-(2-methylprop-2-enyl)aziridine-2-carboxylate;ethane is sourced from PubChem (CID 144578072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).