C21H24FN2+ — CID 144579409
(1R)-5-[2-(4-fluorophenyl)ethyl]-1,8-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-2-ium (PubChem CID 144579409) has the molecular formula C21H24FN2+ and a molecular weight of 323.44 g/mol. Its IUPAC name is (1R)-5-[2-(4-fluorophenyl)ethyl]-1,8-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-2-ium.
| Compound Name | (1R)-5-[2-(4-fluorophenyl)ethyl]-1,8-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 144579409 |
| Molecular Formula | C21H24FN2+ |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (1R)-5-[2-(4-fluorophenyl)ethyl]-1,8-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(F)cc2)CC[NH2+][C@@H]1C |
| InChI | InChI=1S/C21H23FN2/c1-14-3-8-19-18(13-14)21-15(2)23-11-9-20(21)24(19)12-10-16-4-6-17(22)7-5-16/h3-8,13,15,23H,9-12H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | FADNEGQZVWPHMC-OAHLLOKOSA-O |
| XLogP | 3.51 |
| TPSA | 21.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|