About S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane
S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane (PubChem CID 144579884) has the molecular formula C21H34O3S
and a molecular weight of 366.57 g/mol. Its IUPAC name is S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane.
Molecular Properties
| Compound Name | S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane |
| PubChem CID | 144579884 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane |
| SMILES | CC.CCCCSC(=O)c1ccc(C2OCC(CC)(CC)CO2)cc1 |
| InChI | InChI=1S/C19H28O3S.C2H6/c1-4-7-12-23-17(20)15-8-10-16(11-9-15)18-21-13-19(5-2,6-3)14-22-18;1-2/h8-11,18H,4-7,12-14H2,1-3H3;1-2H3 |
| InChIKey | MZPGKKZDFIAWIP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane?
The IUPAC name of S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane (CID 144579884) is S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane.
What is the SMILES notation for S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane?
The canonical SMILES for S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane is CC.CCCCSC(=O)c1ccc(C2OCC(CC)(CC)CO2)cc1.
What is the InChIKey of S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane?
The InChIKey is MZPGKKZDFIAWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O3S.C2H6/c1-4-7-12-23-17(20)15-8-10-16(11-9-15)18-21-13-19(5-2,6-3)14-22-18;1-2/h8-11,18H,4-7,12-14H2,1-3H3;1-2H3.
What are the key properties of S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane?
S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane has a molecular weight of 366.57 g/mol, XLogP of 6.24, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl 4-(5,5-diethyl-1,3-dioxan-2-yl)benzenecarbothioate;ethane is sourced from PubChem (CID 144579884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).