C19H14N2O2 — CID 144579982
2-[[(10Z)-2-oxo-6,7,8,9-tetrahydrocycloocta[g]chromen-3-yl]methylidene]propanedinitrile (PubChem CID 144579982) has the molecular formula C19H14N2O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[[(10Z)-2-oxo-6,7,8,9-tetrahydrocycloocta[g]chromen-3-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[(10Z)-2-oxo-6,7,8,9-tetrahydrocycloocta[g]chromen-3-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 144579982 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[[(10Z)-2-oxo-6,7,8,9-tetrahydrocycloocta[g]chromen-3-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc2cc3c(cc2oc1=O)/C=C\CCCC3 |
| InChI | InChI=1S/C19H14N2O2/c20-11-13(12-21)7-17-9-16-8-14-5-3-1-2-4-6-15(14)10-18(16)23-19(17)22/h4,6-10H,1-3,5H2/b6-4- |
| InChIKey | QNQHHDXQJMWPMN-XQRVVYSFSA-N |
| XLogP | 3.96 |
| TPSA | 77.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|