C22H25N3O4S — CID 144580150
N-[2-[(2E)-2-(1-benzothiophen-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide;ethane (PubChem CID 144580150) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[2-[(2E)-2-(1-benzothiophen-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide;ethane.
| Compound Name | N-[2-[(2E)-2-(1-benzothiophen-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide;ethane |
|---|---|
| PubChem CID | 144580150 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[2-[(2E)-2-(1-benzothiophen-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide;ethane |
| SMILES | CC.COc1ccc(C(=O)NCC(=O)N/N=C/c2csc3ccccc23)cc1OC |
| InChI | InChI=1S/C20H19N3O4S.C2H6/c1-26-16-8-7-13(9-17(16)27-2)20(25)21-11-19(24)23-22-10-14-12-28-18-6-4-3-5-15(14)18;1-2/h3-10,12H,11H2,1-2H3,(H,21,25)(H,23,24);1-2H3/b22-10+; |
| InChIKey | KORUWQGHKQUKMW-UAONINCZSA-N |
| XLogP | 3.82 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|