About N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane
N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane (PubChem CID 144580242) has the molecular formula C11H20BrNO2S
and a molecular weight of 310.26 g/mol. Its IUPAC name is N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane.
Molecular Properties
| Compound Name | N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane |
| PubChem CID | 144580242 |
| Molecular Formula | C11H20BrNO2S |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane |
| SMILES | CC.COC(CNCc1cscc1Br)OC |
| InChI | InChI=1S/C9H14BrNO2S.C2H6/c1-12-9(13-2)4-11-3-7-5-14-6-8(7)10;1-2/h5-6,9,11H,3-4H2,1-2H3;1-2H3 |
| InChIKey | AYUFURFHEMIJQH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane?
The IUPAC name of N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane (CID 144580242) is N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane.
What is the SMILES notation for N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane?
The canonical SMILES for N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane is CC.COC(CNCc1cscc1Br)OC.
What is the InChIKey of N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane?
The InChIKey is AYUFURFHEMIJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrNO2S.C2H6/c1-12-9(13-2)4-11-3-7-5-14-6-8(7)10;1-2/h5-6,9,11H,3-4H2,1-2H3;1-2H3.
What are the key properties of N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane?
N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane has a molecular weight of 310.26 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-bromothiophen-3-yl)methyl]-2,2-dimethoxyethanamine;ethane is sourced from PubChem (CID 144580242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).