C20H27N3O5 — CID 144580421
tert-butyl 9-formamido-5-oxo-4-propan-2-ylspiro[3H-1,4-benzoxazepine-2,3'-azetidine]-1'-carboxylate (PubChem CID 144580421) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is tert-butyl 9-formamido-5-oxo-4-propan-2-ylspiro[3H-1,4-benzoxazepine-2,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl 9-formamido-5-oxo-4-propan-2-ylspiro[3H-1,4-benzoxazepine-2,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 144580421 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl 9-formamido-5-oxo-4-propan-2-ylspiro[3H-1,4-benzoxazepine-2,3'-azetidine]-1'-carboxylate |
| SMILES | CC(C)N1CC2(CN(C(=O)OC(C)(C)C)C2)Oc2c(NC=O)cccc2C1=O |
| InChI | InChI=1S/C20H27N3O5/c1-13(2)23-11-20(9-22(10-20)18(26)28-19(3,4)5)27-16-14(17(23)25)7-6-8-15(16)21-12-24/h6-8,12-13H,9-11H2,1-5H3,(H,21,24) |
| InChIKey | URTHTWZSXBUWET-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|