C22H26N2O4 — CID 144581525
1-(2,5-dimethoxyphenyl)-3-[[4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphenyl]methyl]urea (PubChem CID 144581525) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[[4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphenyl]methyl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[[4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphenyl]methyl]urea |
|---|---|
| PubChem CID | 144581525 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[[4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyphenyl]methyl]urea |
| SMILES | C/C=C\C(=C/C)Oc1ccc(CNC(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-5-7-17(6-2)28-18-10-8-16(9-11-18)15-23-22(25)24-20-14-19(26-3)12-13-21(20)27-4/h5-14H,15H2,1-4H3,(H2,23,24,25)/b7-5-,17-6+ |
| InChIKey | CXTWLVKXXCXBER-APZVSDDJSA-N |
| XLogP | 4.88 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|