About 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate)
3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) (PubChem CID 144581621) has the molecular formula C28H19F3O2S2
and a molecular weight of 508.59 g/mol. Its IUPAC name is 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate).
Molecular Properties
| Compound Name | 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) |
| PubChem CID | 144581621 |
| Molecular Formula | C28H19F3O2S2 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) |
| SMILES | Cc1ccc(-c2ccc(SC(=O)CC(=O)Sc3ccc(-c4ccc(F)c(F)c4)cc3)cc2)cc1F |
| InChI | InChI=1S/C28H19F3O2S2/c1-17-2-3-20(14-25(17)30)18-4-9-22(10-5-18)34-27(32)16-28(33)35-23-11-6-19(7-12-23)21-8-13-24(29)26(31)15-21/h2-15H,16H2,1H3 |
| InChIKey | ITWXGGFJLDELAV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate)?
The IUPAC name of 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) (CID 144581621) is 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate).
What is the SMILES notation for 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate)?
The canonical SMILES for 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) is Cc1ccc(-c2ccc(SC(=O)CC(=O)Sc3ccc(-c4ccc(F)c(F)c4)cc3)cc2)cc1F.
What is the InChIKey of 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate)?
The InChIKey is ITWXGGFJLDELAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19F3O2S2/c1-17-2-3-20(14-25(17)30)18-4-9-22(10-5-18)34-27(32)16-28(33)35-23-11-6-19(7-12-23)21-8-13-24(29)26(31)15-21/h2-15H,16H2,1H3.
What are the key properties of 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate)?
3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) has a molecular weight of 508.59 g/mol, XLogP of 8.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-S-[4-(3,4-difluorophenyl)phenyl] 1-S-[4-(3-fluoro-4-methylphenyl)phenyl] propanebis(thioate) is sourced from PubChem (CID 144581621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).