About ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol
ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol (PubChem CID 144581683) has the molecular formula C17H40N2O2
and a molecular weight of 304.52 g/mol. Its IUPAC name is ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol.
Molecular Properties
| Compound Name | ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol |
| PubChem CID | 144581683 |
| Molecular Formula | C17H40N2O2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol |
| SMILES | CC.CC.CN1CCC(O)CC1.CN1CCCC(CO)C1 |
| InChI | InChI=1S/C7H15NO.C6H13NO.2C2H6/c1-8-4-2-3-7(5-8)6-9;1-7-4-2-6(8)3-5-7;2*1-2/h7,9H,2-6H2,1H3;6,8H,2-5H2,1H3;2*1-2H3 |
| InChIKey | PDRLTPSDQBFROM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol?
The IUPAC name of ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol (CID 144581683) is ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol.
What is the SMILES notation for ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol?
The canonical SMILES for ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol is CC.CC.CN1CCC(O)CC1.CN1CCCC(CO)C1.
What is the InChIKey of ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol?
The InChIKey is PDRLTPSDQBFROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H13NO.2C2H6/c1-8-4-2-3-7(5-8)6-9;1-7-4-2-6(8)3-5-7;2*1-2/h7,9H,2-6H2,1H3;6,8H,2-5H2,1H3;2*1-2H3.
What are the key properties of ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol?
ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol has a molecular weight of 304.52 g/mol, XLogP of 2.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpiperidin-4-ol;(1-methylpiperidin-3-yl)methanol is sourced from PubChem (CID 144581683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).