C9H21NS — CID 144581692
ethane;2,2,4-trimethylthiomorpholine (PubChem CID 144581692) has the molecular formula C9H21NS and a molecular weight of 175.34 g/mol. Its IUPAC name is ethane;2,2,4-trimethylthiomorpholine.
| Compound Name | ethane;2,2,4-trimethylthiomorpholine |
|---|---|
| PubChem CID | 144581692 |
| Molecular Formula | C9H21NS |
| Molecular Weight | 175.34 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | ethane;2,2,4-trimethylthiomorpholine |
| SMILES | CC.CN1CCSC(C)(C)C1 |
| InChI | InChI=1S/C7H15NS.C2H6/c1-7(2)6-8(3)4-5-9-7;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | HGSFXDVPBFQWIR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |