About 2-ethyl-2,6-dimethyl-1,4-thiazine
2-ethyl-2,6-dimethyl-1,4-thiazine (PubChem CID 144581900) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-ethyl-2,6-dimethyl-1,4-thiazine.
Molecular Properties
| Compound Name | 2-ethyl-2,6-dimethyl-1,4-thiazine |
| PubChem CID | 144581900 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-ethyl-2,6-dimethyl-1,4-thiazine |
| SMILES | CCC1(C)C=NC=C(C)S1 |
| InChI | InChI=1S/C8H13NS/c1-4-8(3)6-9-5-7(2)10-8/h5-6H,4H2,1-3H3 |
| InChIKey | SHAVMULPUREFHE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2,6-dimethyl-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,6-dimethyl-1,4-thiazine?
The IUPAC name of 2-ethyl-2,6-dimethyl-1,4-thiazine (CID 144581900) is 2-ethyl-2,6-dimethyl-1,4-thiazine.
What is the SMILES notation for 2-ethyl-2,6-dimethyl-1,4-thiazine?
The canonical SMILES for 2-ethyl-2,6-dimethyl-1,4-thiazine is CCC1(C)C=NC=C(C)S1.
What is the InChIKey of 2-ethyl-2,6-dimethyl-1,4-thiazine?
The InChIKey is SHAVMULPUREFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-4-8(3)6-9-5-7(2)10-8/h5-6H,4H2,1-3H3.
What are the key properties of 2-ethyl-2,6-dimethyl-1,4-thiazine?
2-ethyl-2,6-dimethyl-1,4-thiazine has a molecular weight of 155.27 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,6-dimethyl-1,4-thiazine is sourced from PubChem (CID 144581900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).