C20H24F3O3S+ — CID 144582695
4-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-oxathian-4-ium;3,3,3-trifluoroprop-1-ene (PubChem CID 144582695) has the molecular formula C20H24F3O3S+ and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-oxathian-4-ium;3,3,3-trifluoroprop-1-ene.
| Compound Name | 4-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-oxathian-4-ium;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 144582695 |
| Molecular Formula | C20H24F3O3S+ |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-oxathian-4-ium;3,3,3-trifluoroprop-1-ene |
| SMILES | C=CC(F)(F)F.COCCOc1ccc([S+]2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C17H21O3S.C3H3F3/c1-18-8-9-20-16-6-7-17(21-12-10-19-11-13-21)15-5-3-2-4-14(15)16;1-2-3(4,5)6/h2-7H,8-13H2,1H3;2H,1H2/q+1; |
| InChIKey | MTJGAXRPGPUUGL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|