About 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid
3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid (PubChem CID 144582732) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid |
| PubChem CID | 144582732 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid |
| SMILES | CC(O)COC1COCCCCC(C(=O)O)CO1 |
| InChI | InChI=1S/C12H22O6/c1-9(13)6-17-11-8-16-5-3-2-4-10(7-18-11)12(14)15/h9-11,13H,2-8H2,1H3,(H,14,15) |
| InChIKey | AHSGLYFNZCTSTI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid?
The IUPAC name of 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid (CID 144582732) is 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid.
What is the SMILES notation for 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid?
The canonical SMILES for 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid is CC(O)COC1COCCCCC(C(=O)O)CO1.
What is the InChIKey of 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid?
The InChIKey is AHSGLYFNZCTSTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6/c1-9(13)6-17-11-8-16-5-3-2-4-10(7-18-11)12(14)15/h9-11,13H,2-8H2,1H3,(H,14,15).
What are the key properties of 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid?
3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid has a molecular weight of 262.30 g/mol, XLogP of 0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxypropoxy)-1,4-dioxecane-6-carboxylic acid is sourced from PubChem (CID 144582732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).