About 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane
3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane (PubChem CID 144583088) has the molecular formula C17H22S2
and a molecular weight of 290.50 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane |
| PubChem CID | 144583088 |
| Molecular Formula | C17H22S2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane |
| SMILES | C=C/C=C\c1c(S)sc2c(CC)cccc12.CCC |
| InChI | InChI=1S/C14H14S2.C3H8/c1-3-5-8-12-11-9-6-7-10(4-2)13(11)16-14(12)15;1-3-2/h3,5-9,15H,1,4H2,2H3;3H2,1-2H3/b8-5-; |
| InChIKey | AFOFJGKRAVTFHW-HGKIGUAWSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane (CID 144583088) is 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane is C=C/C=C\c1c(S)sc2c(CC)cccc12.CCC.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane?
The InChIKey is AFOFJGKRAVTFHW-HGKIGUAWSA-N. The full InChI is InChI=1S/C14H14S2.C3H8/c1-3-5-8-12-11-9-6-7-10(4-2)13(11)16-14(12)15;1-3-2/h3,5-9,15H,1,4H2,2H3;3H2,1-2H3/b8-5-;.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane?
3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane has a molecular weight of 290.50 g/mol, XLogP of 6.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-7-ethyl-1-benzothiophene-2-thiol;propane is sourced from PubChem (CID 144583088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).