About molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine
molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine (PubChem CID 144583788) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine.
Molecular Properties
| Compound Name | molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine |
| PubChem CID | 144583788 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine |
| SMILES | [H]/N=C/C(C)=C1\C=C(C)CC(C)(C)C1.[H][H] |
| InChI | InChI=1S/C12H19N.H2/c1-9-5-11(10(2)8-13)7-12(3,4)6-9;/h5,8,13H,6-7H2,1-4H3;1H/b11-10+,13-8+; |
| InChIKey | YWHFFRVSZWUDLU-UIUDXVRCSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine?
The IUPAC name of molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine (CID 144583788) is molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine.
What is the SMILES notation for molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine?
The canonical SMILES for molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine is [H]/N=C/C(C)=C1\C=C(C)CC(C)(C)C1.[H][H].
What is the InChIKey of molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine?
The InChIKey is YWHFFRVSZWUDLU-UIUDXVRCSA-N. The full InChI is InChI=1S/C12H19N.H2/c1-9-5-11(10(2)8-13)7-12(3,4)6-9;/h5,8,13H,6-7H2,1-4H3;1H/b11-10+,13-8+;.
What are the key properties of molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine?
molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine has a molecular weight of 179.31 g/mol, XLogP of 3.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;(2Z)-2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-1-imine is sourced from PubChem (CID 144583788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).